C7H11N5O3S — CID 110484766
5-amino-N-(1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide (PubChem CID 110484766) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110484766 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide |
| SMILES | Nc1n[nH]nc1C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H11N5O3S/c8-6-5(10-12-11-6)7(13)9-4-1-2-16(14,15)3-4/h4H,1-3H2,(H,9,13)(H3,8,10,11,12) |
| InChIKey | UAHMJIGLPFJAAA-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |