C9H11N3O4S — CID 30789067
N-[(3S)-1,1-dioxothiolan-3-yl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 30789067) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 30789067 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C9H11N3O4S/c13-8-2-1-7(11-12-8)9(14)10-6-3-4-17(15,16)5-6/h1-2,6H,3-5H2,(H,10,14)(H,12,13)/t6-/m0/s1 |
| InChIKey | YDVQFJXMHNYZSO-LURJTMIESA-N |
| XLogP | -1.31 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |