C12H16N2O4S — CID 156586122
N-(1,1-dioxothiolan-3-yl)-2-ethyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 156586122) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-ethyl-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-ethyl-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156586122 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-ethyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCc1[nH]c(=O)ccc1C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16N2O4S/c1-2-10-9(3-4-11(15)14-10)12(16)13-8-5-6-19(17,18)7-8/h3-4,8H,2,5-7H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | FZRRULYDUYTFBB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |