C10H11N3O2 — CID 103762323
N-cyclopent-3-en-1-yl-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 103762323) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-cyclopent-3-en-1-yl-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103762323 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-cyclopent-3-en-1-yl-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NC1CC=CC1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H11N3O2/c14-9-6-5-8(12-13-9)10(15)11-7-3-1-2-4-7/h1-2,5-7H,3-4H2,(H,11,15)(H,13,14) |
| InChIKey | IXDJUQVICVYNFZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|