C13H15N5O3 — CID 108554971
N-[1-(2-cyanoacetyl)piperidin-4-yl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 108554971) has the molecular formula C13H15N5O3 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[1-(2-cyanoacetyl)piperidin-4-yl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[1-(2-cyanoacetyl)piperidin-4-yl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108554971 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[1-(2-cyanoacetyl)piperidin-4-yl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | N#CCC(=O)N1CCC(NC(=O)c2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C13H15N5O3/c14-6-3-12(20)18-7-4-9(5-8-18)15-13(21)10-1-2-11(19)17-16-10/h1-2,9H,3-5,7-8H2,(H,15,21)(H,17,19) |
| InChIKey | GOFPPHGHAZBLLC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |