C10H13N3O4S — CID 113223754
N-(1,1-dioxothian-4-yl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 113223754) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 113223754 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H13N3O4S/c14-9-2-1-8(12-13-9)10(15)11-7-3-5-18(16,17)6-4-7/h1-2,7H,3-6H2,(H,11,15)(H,13,14) |
| InChIKey | BGDWTAMSMHVDFX-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |