C8H11N3O3S — CID 43533019
N-(1,1-dioxothiolan-3-yl)-1H-pyrazole-4-carboxamide (PubChem CID 43533019) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43533019 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cn[nH]c1 |
| InChI | InChI=1S/C8H11N3O3S/c12-8(6-3-9-10-4-6)11-7-1-2-15(13,14)5-7/h3-4,7H,1-2,5H2,(H,9,10)(H,11,12) |
| InChIKey | LJIKMRCRPYILPJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |