C14H22N4O3S — CID 77088115
N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-1H-pyrazole-4-carboxamide (PubChem CID 77088115) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 77088115 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCN(C2CCS(=O)(=O)CC2)CC1)c1cn[nH]c1 |
| InChI | InChI=1S/C14H22N4O3S/c19-14(11-9-15-16-10-11)17-12-1-5-18(6-2-12)13-3-7-22(20,21)8-4-13/h9-10,12-13H,1-8H2,(H,15,16)(H,17,19) |
| InChIKey | AWLIOCXITCLKFX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |