C14H22N4O2 — CID 99929059
N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-pyrazole-4-carboxamide (PubChem CID 99929059) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 99929059 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCN(C[C@@H]2CCCO2)CC1)c1cn[nH]c1 |
| InChI | InChI=1S/C14H22N4O2/c19-14(11-8-15-16-9-11)17-12-3-5-18(6-4-12)10-13-2-1-7-20-13/h8-9,12-13H,1-7,10H2,(H,15,16)(H,17,19)/t13-/m0/s1 |
| InChIKey | KRUKHAZWPYFILJ-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |