C10H15N3O — CID 43532859
N-cyclohexyl-1H-pyrazole-4-carboxamide (PubChem CID 43532859) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N-cyclohexyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-cyclohexyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43532859 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-cyclohexyl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cn[nH]c1 |
| InChI | InChI=1S/C10H15N3O/c14-10(8-6-11-12-7-8)13-9-4-2-1-3-5-9/h6-7,9H,1-5H2,(H,11,12)(H,13,14) |
| InChIKey | BADVQRNIWIEIPS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |