C18H24Cl2N2O2 — CID 72896765
3,5-dichloro-4-methyl-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 72896765) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 3,5-dichloro-4-methyl-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | 3,5-dichloro-4-methyl-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 72896765 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3,5-dichloro-4-methyl-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | Cc1c(Cl)cc(C(=O)NC2CCN(CC3CCCO3)CC2)cc1Cl |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-12-16(19)9-13(10-17(12)20)18(23)21-14-4-6-22(7-5-14)11-15-3-2-8-24-15/h9-10,14-15H,2-8,11H2,1H3,(H,21,23) |
| InChIKey | NQZKSWUYMGSRNG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |