C21H32N4O3 — CID 74243085
N-[2-methyl-5-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]carbamoylamino]phenyl]propanamide (PubChem CID 74243085) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[2-methyl-5-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]carbamoylamino]phenyl]propanamide.
| Compound Name | N-[2-methyl-5-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]carbamoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 74243085 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[2-methyl-5-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]carbamoylamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(NC(=O)NC2CCN(CC3CCCO3)CC2)ccc1C |
| InChI | InChI=1S/C21H32N4O3/c1-3-20(26)24-19-13-17(7-6-15(19)2)23-21(27)22-16-8-10-25(11-9-16)14-18-5-4-12-28-18/h6-7,13,16,18H,3-5,8-12,14H2,1-2H3,(H,24,26)(H2,22,23,27) |
| InChIKey | BOFWYQDBBJUYHV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |