C20H29N3O3 — CID 118777017
1-[1-(oxolan-2-ylmethyl)piperidin-4-yl]-3-(3-prop-2-enoxyphenyl)urea (PubChem CID 118777017) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[1-(oxolan-2-ylmethyl)piperidin-4-yl]-3-(3-prop-2-enoxyphenyl)urea.
| Compound Name | 1-[1-(oxolan-2-ylmethyl)piperidin-4-yl]-3-(3-prop-2-enoxyphenyl)urea |
|---|---|
| PubChem CID | 118777017 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-[1-(oxolan-2-ylmethyl)piperidin-4-yl]-3-(3-prop-2-enoxyphenyl)urea |
| SMILES | C=CCOc1cccc(NC(=O)NC2CCN(CC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-12-25-18-6-3-5-17(14-18)22-20(24)21-16-8-10-23(11-9-16)15-19-7-4-13-26-19/h2-3,5-6,14,16,19H,1,4,7-13,15H2,(H2,21,22,24) |
| InChIKey | FHFJLYWZLNWHCT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|