C20H28N6O2 — CID 136578364
1-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea (PubChem CID 136578364) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea.
| Compound Name | 1-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 136578364 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1cnn(CC2CCCO2)c1)NC1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H28N6O2/c27-20(24-18-12-22-26(14-18)15-19-2-1-11-28-19)23-17-5-9-25(10-6-17)13-16-3-7-21-8-4-16/h3-4,7-8,12,14,17,19H,1-2,5-6,9-11,13,15H2,(H2,23,24,27) |
| InChIKey | JFKHFRGAIZFLMA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |