C17H29N5O2 — CID 136578353
1-[2-(4-methylpiperidin-1-yl)ethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 136578353) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[2-(4-methylpiperidin-1-yl)ethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[2-(4-methylpiperidin-1-yl)ethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 136578353 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-[2-(4-methylpiperidin-1-yl)ethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | CC1CCN(CCNC(=O)Nc2cnn(CC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C17H29N5O2/c1-14-4-7-21(8-5-14)9-6-18-17(23)20-15-11-19-22(12-15)13-16-3-2-10-24-16/h11-12,14,16H,2-10,13H2,1H3,(H2,18,20,23) |
| InChIKey | QNLDWBMCTNHNNP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |