C16H28N4O3 — CID 136517483
1-[2-ethyl-2-(hydroxymethyl)butyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 136517483) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-[2-ethyl-2-(hydroxymethyl)butyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[2-ethyl-2-(hydroxymethyl)butyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 136517483 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-[2-ethyl-2-(hydroxymethyl)butyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | CCC(CC)(CO)CNC(=O)Nc1cnn(CC2CCCO2)c1 |
| InChI | InChI=1S/C16H28N4O3/c1-3-16(4-2,12-21)11-17-15(22)19-13-8-18-20(9-13)10-14-6-5-7-23-14/h8-9,14,21H,3-7,10-12H2,1-2H3,(H2,17,19,22) |
| InChIKey | FVXNZUAOUQZUAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |