C16H27N5O3 — CID 86863097
N-butan-2-yl-2-[[1-(oxolan-2-ylmethyl)pyrazol-4-yl]carbamoylamino]propanamide (PubChem CID 86863097) has the molecular formula C16H27N5O3 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-butan-2-yl-2-[[1-(oxolan-2-ylmethyl)pyrazol-4-yl]carbamoylamino]propanamide.
| Compound Name | N-butan-2-yl-2-[[1-(oxolan-2-ylmethyl)pyrazol-4-yl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 86863097 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | N-butan-2-yl-2-[[1-(oxolan-2-ylmethyl)pyrazol-4-yl]carbamoylamino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)NC(=O)Nc1cnn(CC2CCCO2)c1 |
| InChI | InChI=1S/C16H27N5O3/c1-4-11(2)18-15(22)12(3)19-16(23)20-13-8-17-21(9-13)10-14-6-5-7-24-14/h8-9,11-12,14H,4-7,10H2,1-3H3,(H,18,22)(H2,19,20,23) |
| InChIKey | MSMWTEXMANNURZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |