C10H14BrN3O3S — CID 45147682
4-bromo-N-(1,1-dioxothiolan-3-yl)-1-ethylpyrazole-3-carboxamide (PubChem CID 45147682) has the molecular formula C10H14BrN3O3S and a molecular weight of 336.21 g/mol. Its IUPAC name is 4-bromo-N-(1,1-dioxothiolan-3-yl)-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 45147682 |
| Molecular Formula | C10H14BrN3O3S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H14BrN3O3S/c1-2-14-5-8(11)9(13-14)10(15)12-7-3-4-18(16,17)6-7/h5,7H,2-4,6H2,1H3,(H,12,15) |
| InChIKey | WCDCOKNRVIRPCY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |