C11H18N4O3S — CID 65358133
4-amino-N-(1,1-dioxothian-4-yl)-1-ethylpyrazole-3-carboxamide (PubChem CID 65358133) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-amino-N-(1,1-dioxothian-4-yl)-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(1,1-dioxothian-4-yl)-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65358133 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-amino-N-(1,1-dioxothian-4-yl)-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)NC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C11H18N4O3S/c1-2-15-7-9(12)10(14-15)11(16)13-8-3-5-19(17,18)6-4-8/h7-8H,2-6,12H2,1H3,(H,13,16) |
| InChIKey | MYZIXVADNVTMHZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |