C12H17BrN2O3S — CID 43640729
4-bromo-N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 43640729) has the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. Its IUPAC name is 4-bromo-N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43640729 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17BrN2O3S/c1-8(2)15-6-9(13)5-11(15)12(16)14-10-3-4-19(17,18)7-10/h5-6,8,10H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | PTQHRCSRVUHDQT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |