C16H20N2O3S — CID 97264616
N-[(3R)-1,1-dioxothiolan-3-yl]-1-propan-2-ylindole-6-carboxamide (PubChem CID 97264616) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-1-propan-2-ylindole-6-carboxamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-propan-2-ylindole-6-carboxamide |
|---|---|
| PubChem CID | 97264616 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-propan-2-ylindole-6-carboxamide |
| SMILES | CC(C)n1ccc2ccc(C(=O)N[C@@H]3CCS(=O)(=O)C3)cc21 |
| InChI | InChI=1S/C16H20N2O3S/c1-11(2)18-7-5-12-3-4-13(9-15(12)18)16(19)17-14-6-8-22(20,21)10-14/h3-5,7,9,11,14H,6,8,10H2,1-2H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | KKZJFPWACGWXBV-CQSZACIVSA-N |
| XLogP | 2.14 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |