C9H15N5O2 — CID 62792850
3-amino-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62792850) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-amino-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 62792850 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-amino-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NCC2CCCCO2)n1 |
| InChI | InChI=1S/C9H15N5O2/c10-9-12-7(13-14-9)8(15)11-5-6-3-1-2-4-16-6/h6H,1-5H2,(H,11,15)(H3,10,12,13,14) |
| InChIKey | JMOKTUPMBNFRMS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |