C8H15N5O — CID 66277519
3-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 66277519) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 66277519 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 3-N-(oxan-2-ylmethyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NCC2CCCCO2)n[nH]1 |
| InChI | InChI=1S/C8H15N5O/c9-7-11-8(13-12-7)10-5-6-3-1-2-4-14-6/h6H,1-5H2,(H4,9,10,11,12,13) |
| InChIKey | QGRRXNWTKYYAGB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |