C11H18N4O — CID 114448388
5,6-dimethyl-N-(oxan-2-ylmethyl)-1,2,4-triazin-3-amine (PubChem CID 114448388) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 5,6-dimethyl-N-(oxan-2-ylmethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(oxan-2-ylmethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114448388 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 5,6-dimethyl-N-(oxan-2-ylmethyl)-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCC2CCCCO2)nc1C |
| InChI | InChI=1S/C11H18N4O/c1-8-9(2)14-15-11(13-8)12-7-10-5-3-4-6-16-10/h10H,3-7H2,1-2H3,(H,12,13,15) |
| InChIKey | MPDQIKQRXSFAEN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |