C9H11Cl2N3O — CID 124585342
4,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyrimidin-2-amine (PubChem CID 124585342) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is 4,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyrimidin-2-amine.
| Compound Name | 4,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 124585342 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 4,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyrimidin-2-amine |
| SMILES | Clc1cc(Cl)nc(NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C9H11Cl2N3O/c10-7-4-8(11)14-9(13-7)12-5-6-2-1-3-15-6/h4,6H,1-3,5H2,(H,12,13,14)/t6-/m0/s1 |
| InChIKey | KZVCTVDNYOKJOO-LURJTMIESA-N |
| XLogP | 2.37 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |