C9H17N3O — CID 115601377
N-(oxan-2-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 115601377) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(oxan-2-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(oxan-2-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 115601377 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-(oxan-2-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C1CCC(CNC2=NCCN2)OC1 |
| InChI | InChI=1S/C9H17N3O/c1-2-6-13-8(3-1)7-12-9-10-4-5-11-9/h8H,1-7H2,(H2,10,11,12) |
| InChIKey | NFXMKHWSRWGFEJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |