C11H16N2O2 — CID 110848900
N-cyclohexyl-4-methyl-1,2-oxazole-3-carboxamide (PubChem CID 110848900) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-cyclohexyl-4-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110848900 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-cyclohexyl-4-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1conc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H16N2O2/c1-8-7-15-13-10(8)11(14)12-9-5-3-2-4-6-9/h7,9H,2-6H2,1H3,(H,12,14) |
| InChIKey | OFBSNPDSIHFKJT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |