C9H12N2O2 — CID 110689453
N-cyclopentyl-1,3-oxazole-4-carboxamide (PubChem CID 110689453) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is N-cyclopentyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-cyclopentyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110689453 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-cyclopentyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cocn1 |
| InChI | InChI=1S/C9H12N2O2/c12-9(8-5-13-6-10-8)11-7-3-1-2-4-7/h5-7H,1-4H2,(H,11,12) |
| InChIKey | GDWORJMZPKYMEL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |