C10H15N3O2 — CID 110848950
2-amino-N-cyclohexyl-1,3-oxazole-4-carboxamide (PubChem CID 110848950) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-amino-N-cyclohexyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-amino-N-cyclohexyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110848950 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-amino-N-cyclohexyl-1,3-oxazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)NC2CCCCC2)co1 |
| InChI | InChI=1S/C10H15N3O2/c11-10-13-8(6-15-10)9(14)12-7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,11,13)(H,12,14) |
| InChIKey | GYFHJFBOWDMNOJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |