C13H21N3O — CID 43582836
N-cycloheptyl-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 43582836) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N-cycloheptyl-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-cycloheptyl-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43582836 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-cycloheptyl-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C13H21N3O/c1-9-12(10(2)16-15-9)13(17)14-11-7-5-3-4-6-8-11/h11H,3-8H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | JXNUDSJBGOYXSM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |