C14H21N3O2 — CID 136890080
N-cycloheptyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136890080) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-cycloheptyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-cycloheptyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136890080 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-cycloheptyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NC2CCCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H21N3O2/c1-9-12(13(18)16-10(2)15-9)14(19)17-11-7-5-3-4-6-8-11/h11H,3-8H2,1-2H3,(H,17,19)(H,15,16,18) |
| InChIKey | JBJCGMDYHYKIIM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |