C12H17N3O4 — CID 66522617
N-cyclohexyl-6-hydroxy-1-methyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 66522617) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is N-cyclohexyl-6-hydroxy-1-methyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-6-hydroxy-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66522617 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-cyclohexyl-6-hydroxy-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | Cn1c(O)c(C(=O)NC2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O4/c1-15-11(18)8(10(17)14-12(15)19)9(16)13-7-5-3-2-4-6-7/h7,18H,2-6H2,1H3,(H,13,16)(H,14,17,19) |
| InChIKey | LYIZXGIFONSPPS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |