C18H21N3O4 — CID 66522623
1-benzyl-N-cyclohexyl-6-hydroxy-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 66522623) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-benzyl-N-cyclohexyl-6-hydroxy-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | 1-benzyl-N-cyclohexyl-6-hydroxy-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66522623 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-benzyl-N-cyclohexyl-6-hydroxy-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1c(O)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H21N3O4/c22-15(19-13-9-5-2-6-10-13)14-16(23)20-18(25)21(17(14)24)11-12-7-3-1-4-8-12/h1,3-4,7-8,13,24H,2,5-6,9-11H2,(H,19,22)(H,20,23,25) |
| InChIKey | YZGTVHKSEPGUCU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |