C18H22N2O3 — CID 90901292
5-benzyl-N-cyclohexyl-2,4-dioxopyrrolidine-3-carboxamide (PubChem CID 90901292) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 5-benzyl-N-cyclohexyl-2,4-dioxopyrrolidine-3-carboxamide.
| Compound Name | 5-benzyl-N-cyclohexyl-2,4-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90901292 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 5-benzyl-N-cyclohexyl-2,4-dioxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1C(=O)NC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H22N2O3/c21-16-14(11-12-7-3-1-4-8-12)20-18(23)15(16)17(22)19-13-9-5-2-6-10-13/h1,3-4,7-8,13-15H,2,5-6,9-11H2,(H,19,22)(H,20,23) |
| InChIKey | IOASPSILFUOODX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|