C23H20N2O3S — CID 90718416
5-benzyl-2,4-dioxo-N-[(4-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 90718416) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-benzyl-2,4-dioxo-N-[(4-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | 5-benzyl-2,4-dioxo-N-[(4-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90718416 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 5-benzyl-2,4-dioxo-N-[(4-thiophen-2-ylphenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(-c2cccs2)cc1)C1C(=O)NC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H20N2O3S/c26-21-18(13-15-5-2-1-3-6-15)25-23(28)20(21)22(27)24-14-16-8-10-17(11-9-16)19-7-4-12-29-19/h1-12,18,20H,13-14H2,(H,24,27)(H,25,28) |
| InChIKey | ZRBSUAYALJTUDD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|