C18H17NO4S — CID 167917201
1-[(4-thiophen-2-ylphenyl)methylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (PubChem CID 167917201) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[(4-thiophen-2-ylphenyl)methylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid.
| Compound Name | 1-[(4-thiophen-2-ylphenyl)methylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
|---|---|
| PubChem CID | 167917201 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-[(4-thiophen-2-ylphenyl)methylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
| SMILES | O=C(O)C12COC(C(=O)NCc3ccc(-c4cccs4)cc3)(C1)C2 |
| InChI | InChI=1S/C18H17NO4S/c20-15(18-9-17(10-18,11-23-18)16(21)22)19-8-12-3-5-13(6-4-12)14-2-1-7-24-14/h1-7H,8-11H2,(H,19,20)(H,21,22) |
| InChIKey | JNWXUSDFTLPWQN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |