About 4-thiophen-2-ylbenzoyl chloride
4-thiophen-2-ylbenzoyl chloride (PubChem CID 158319353) has the molecular formula C22H14Cl2O2S2
and a molecular weight of 445.39 g/mol. Its IUPAC name is 4-thiophen-2-ylbenzoyl chloride.
Molecular Properties
| Compound Name | 4-thiophen-2-ylbenzoyl chloride |
| PubChem CID | 158319353 |
| Molecular Formula | C22H14Cl2O2S2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 4-thiophen-2-ylbenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(-c2cccs2)cc1.O=C(Cl)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/2C11H7ClOS/c2*12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h2*1-7H |
| InChIKey | GOQOILZJMQYUTD-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-thiophen-2-ylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-ylbenzoyl chloride?
The IUPAC name of 4-thiophen-2-ylbenzoyl chloride (CID 158319353) is 4-thiophen-2-ylbenzoyl chloride.
What is the SMILES notation for 4-thiophen-2-ylbenzoyl chloride?
The canonical SMILES for 4-thiophen-2-ylbenzoyl chloride is O=C(Cl)c1ccc(-c2cccs2)cc1.O=C(Cl)c1ccc(-c2cccs2)cc1.
What is the InChIKey of 4-thiophen-2-ylbenzoyl chloride?
The InChIKey is GOQOILZJMQYUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H7ClOS/c2*12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h2*1-7H.
What are the key properties of 4-thiophen-2-ylbenzoyl chloride?
4-thiophen-2-ylbenzoyl chloride has a molecular weight of 445.39 g/mol, XLogP of 7.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-ylbenzoyl chloride is sourced from PubChem (CID 158319353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).