About 4-thiophen-2-ylbenzamide;hydrochloride
4-thiophen-2-ylbenzamide;hydrochloride (PubChem CID 175969827) has the molecular formula C11H10ClNOS
and a molecular weight of 239.73 g/mol. Its IUPAC name is 4-thiophen-2-ylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-thiophen-2-ylbenzamide;hydrochloride |
| PubChem CID | 175969827 |
| Molecular Formula | C11H10ClNOS |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 4-thiophen-2-ylbenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C11H9NOS.ClH/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10;/h1-7H,(H2,12,13);1H |
| InChIKey | RTFCVVBVZPSKSJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-thiophen-2-ylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-ylbenzamide;hydrochloride?
The IUPAC name of 4-thiophen-2-ylbenzamide;hydrochloride (CID 175969827) is 4-thiophen-2-ylbenzamide;hydrochloride.
What is the SMILES notation for 4-thiophen-2-ylbenzamide;hydrochloride?
The canonical SMILES for 4-thiophen-2-ylbenzamide;hydrochloride is Cl.NC(=O)c1ccc(-c2cccs2)cc1.
What is the InChIKey of 4-thiophen-2-ylbenzamide;hydrochloride?
The InChIKey is RTFCVVBVZPSKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS.ClH/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10;/h1-7H,(H2,12,13);1H.
What are the key properties of 4-thiophen-2-ylbenzamide;hydrochloride?
4-thiophen-2-ylbenzamide;hydrochloride has a molecular weight of 239.73 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-ylbenzamide;hydrochloride is sourced from PubChem (CID 175969827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).