C28H28N2O6S2 — CID 141004447
3,4-dihydroxy-2,5-bis[(4-thiophen-2-ylphenyl)methoxy]hexanediamide (PubChem CID 141004447) has the molecular formula C28H28N2O6S2 and a molecular weight of 552.67 g/mol. Its IUPAC name is 3,4-dihydroxy-2,5-bis[(4-thiophen-2-ylphenyl)methoxy]hexanediamide.
| Compound Name | 3,4-dihydroxy-2,5-bis[(4-thiophen-2-ylphenyl)methoxy]hexanediamide |
|---|---|
| PubChem CID | 141004447 |
| Molecular Formula | C28H28N2O6S2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 3,4-dihydroxy-2,5-bis[(4-thiophen-2-ylphenyl)methoxy]hexanediamide |
| SMILES | NC(=O)C(OCc1ccc(-c2cccs2)cc1)C(O)C(O)C(OCc1ccc(-c2cccs2)cc1)C(N)=O |
| InChI | InChI=1S/C28H28N2O6S2/c29-27(33)25(35-15-17-5-9-19(10-6-17)21-3-1-13-37-21)23(31)24(32)26(28(30)34)36-16-18-7-11-20(12-8-18)22-4-2-14-38-22/h1-14,23-26,31-32H,15-16H2,(H2,29,33)(H2,30,34) |
| InChIKey | SHUMDHXVUKSESJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |