C20H26N4O6 — CID 68503681
(2R,3S,4S,5S)-2,3-bis[(4-aminophenyl)methoxy]-4,5-dihydroxyhexanediamide (PubChem CID 68503681) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2,3-bis[(4-aminophenyl)methoxy]-4,5-dihydroxyhexanediamide.
| Compound Name | (2R,3S,4S,5S)-2,3-bis[(4-aminophenyl)methoxy]-4,5-dihydroxyhexanediamide |
|---|---|
| PubChem CID | 68503681 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2R,3S,4S,5S)-2,3-bis[(4-aminophenyl)methoxy]-4,5-dihydroxyhexanediamide |
| SMILES | NC(=O)[C@@H](O)[C@H](O)[C@H](OCc1ccc(N)cc1)[C@@H](OCc1ccc(N)cc1)C(N)=O |
| InChI | InChI=1S/C20H26N4O6/c21-13-5-1-11(2-6-13)9-29-17(15(25)16(26)19(23)27)18(20(24)28)30-10-12-3-7-14(22)8-4-12/h1-8,15-18,25-26H,9-10,21-22H2,(H2,23,27)(H2,24,28)/t15-,16-,17-,18+/m0/s1 |
| InChIKey | SJMMAOZJMWHWQW-XLAORIBOSA-N |
| XLogP | -0.99 |
| TPSA | 197.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|