C9H12N2O3 — CID 175494072
[(2S)-2-(4-aminophenyl)-2-hydroxyethyl] carbamate (PubChem CID 175494072) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is [(2S)-2-(4-aminophenyl)-2-hydroxyethyl] carbamate.
| Compound Name | [(2S)-2-(4-aminophenyl)-2-hydroxyethyl] carbamate |
|---|---|
| PubChem CID | 175494072 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | [(2S)-2-(4-aminophenyl)-2-hydroxyethyl] carbamate |
| SMILES | NC(=O)OC[C@@H](O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H12N2O3/c10-7-3-1-6(2-4-7)8(12)5-14-9(11)13/h1-4,8,12H,5,10H2,(H2,11,13)/t8-/m1/s1 |
| InChIKey | UGHFSSXJQBJPJN-MRVPVSSYSA-N |
| XLogP | 0.40 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|