C14H12Cl3NO2 — CID 62265767
1-(4-aminophenyl)-2-(2,4,5-trichlorophenoxy)ethanol (PubChem CID 62265767) has the molecular formula C14H12Cl3NO2 and a molecular weight of 332.61 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(2,4,5-trichlorophenoxy)ethanol.
| Compound Name | 1-(4-aminophenyl)-2-(2,4,5-trichlorophenoxy)ethanol |
|---|---|
| PubChem CID | 62265767 |
| Molecular Formula | C14H12Cl3NO2 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 1-(4-aminophenyl)-2-(2,4,5-trichlorophenoxy)ethanol |
| SMILES | Nc1ccc(C(O)COc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl3NO2/c15-10-5-12(17)14(6-11(10)16)20-7-13(19)8-1-3-9(18)4-2-8/h1-6,13,19H,7,18H2 |
| InChIKey | TZIVFYIUXJEFPW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|