C14H13Br2NO2 — CID 64718642
1-(4-aminophenyl)-2-(2,4-dibromophenoxy)ethanol (PubChem CID 64718642) has the molecular formula C14H13Br2NO2 and a molecular weight of 387.07 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(2,4-dibromophenoxy)ethanol.
| Compound Name | 1-(4-aminophenyl)-2-(2,4-dibromophenoxy)ethanol |
|---|---|
| PubChem CID | 64718642 |
| Molecular Formula | C14H13Br2NO2 |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 1-(4-aminophenyl)-2-(2,4-dibromophenoxy)ethanol |
| SMILES | Nc1ccc(C(O)COc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C14H13Br2NO2/c15-10-3-6-14(12(16)7-10)19-8-13(18)9-1-4-11(17)5-2-9/h1-7,13,18H,8,17H2 |
| InChIKey | QETRZQUBEAANKU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|