3-(2,4-dibromophenoxy)-2-methylpropanoic acid

C10H10Br2O3 — CID 43538016

IUPAC3-(2,4-dibromophenoxy)-2-methylpropanoic acid
SMILESCC(COc1ccc(Br)cc1Br)C(=O)O
InChIInChI=1S/C10H10Br2O3/c1-6(10(13)14)5-15-9-3-2-7(11)4-8(9)12/h2-4,6H,5H2,1H3,(H,13,14)
InChIKeyHXMPIHSCNVTEQI-UHFFFAOYSA-N
MW338.00 g/mol
LogP3.31
Rot. Bonds4

About 3-(2,4-dibromophenoxy)-2-methylpropanoic acid

3-(2,4-dibromophenoxy)-2-methylpropanoic acid (PubChem CID 43538016) has the molecular formula C10H10Br2O3 and a molecular weight of 338.00 g/mol. Its IUPAC name is 3-(2,4-dibromophenoxy)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(2,4-dibromophenoxy)-2-methylpropanoic acid
PubChem CID43538016
Molecular FormulaC10H10Br2O3
Molecular Weight338.00 g/mol
Exact Mass335.90
IUPAC Name3-(2,4-dibromophenoxy)-2-methylpropanoic acid
SMILESCC(COc1ccc(Br)cc1Br)C(=O)O
InChIInChI=1S/C10H10Br2O3/c1-6(10(13)14)5-15-9-3-2-7(11)4-8(9)12/h2-4,6H,5H2,1H3,(H,13,14)
InChIKeyHXMPIHSCNVTEQI-UHFFFAOYSA-N
XLogP3.31
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.00
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,4-dibromophenoxy)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dibromophenoxy)-2-methylpropanoic acid?
The IUPAC name of 3-(2,4-dibromophenoxy)-2-methylpropanoic acid (CID 43538016) is 3-(2,4-dibromophenoxy)-2-methylpropanoic acid.
What is the SMILES notation for 3-(2,4-dibromophenoxy)-2-methylpropanoic acid?
The canonical SMILES for 3-(2,4-dibromophenoxy)-2-methylpropanoic acid is CC(COc1ccc(Br)cc1Br)C(=O)O.
What is the InChIKey of 3-(2,4-dibromophenoxy)-2-methylpropanoic acid?
The InChIKey is HXMPIHSCNVTEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br2O3/c1-6(10(13)14)5-15-9-3-2-7(11)4-8(9)12/h2-4,6H,5H2,1H3,(H,13,14).
What are the key properties of 3-(2,4-dibromophenoxy)-2-methylpropanoic acid?
3-(2,4-dibromophenoxy)-2-methylpropanoic acid has a molecular weight of 338.00 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dibromophenoxy)-2-methylpropanoic acid is sourced from PubChem (CID 43538016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).