(2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid

C11H11Br2NO4 — CID 54991092

IUPAC(2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid
SMILESC[C@@H](NC(=O)COc1ccc(Br)cc1Br)C(=O)O
InChIInChI=1S/C11H11Br2NO4/c1-6(11(16)17)14-10(15)5-18-9-3-2-7(12)4-8(9)13/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)/t6-/m1/s1
InChIKeyICSIRFVIBDTABI-ZCFIWIBFSA-N
MW381.02 g/mol
LogP2.18
Rot. Bonds5

About (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid

(2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid (PubChem CID 54991092) has the molecular formula C11H11Br2NO4 and a molecular weight of 381.02 g/mol. Its IUPAC name is (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid
PubChem CID54991092
Molecular FormulaC11H11Br2NO4
Molecular Weight381.02 g/mol
Exact Mass378.91
IUPAC Name(2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid
SMILESC[C@@H](NC(=O)COc1ccc(Br)cc1Br)C(=O)O
InChIInChI=1S/C11H11Br2NO4/c1-6(11(16)17)14-10(15)5-18-9-3-2-7(12)4-8(9)13/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)/t6-/m1/s1
InChIKeyICSIRFVIBDTABI-ZCFIWIBFSA-N
XLogP2.18
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500381.02
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid?
The IUPAC name of (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid (CID 54991092) is (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid.
What is the SMILES notation for (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid?
The canonical SMILES for (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid is C[C@@H](NC(=O)COc1ccc(Br)cc1Br)C(=O)O.
What is the InChIKey of (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid?
The InChIKey is ICSIRFVIBDTABI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H11Br2NO4/c1-6(11(16)17)14-10(15)5-18-9-3-2-7(12)4-8(9)13/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)/t6-/m1/s1.
What are the key properties of (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid?
(2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid has a molecular weight of 381.02 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[2-(2,4-dibromophenoxy)acetyl]amino]propanoic acid is sourced from PubChem (CID 54991092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).