C14H19Br2NO3 — CID 103862131
2-(2,4-dibromophenoxy)-N-(5-hydroxy-4-methylpentyl)acetamide (PubChem CID 103862131) has the molecular formula C14H19Br2NO3 and a molecular weight of 409.12 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-(5-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-(5-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 103862131 |
| Molecular Formula | C14H19Br2NO3 |
| Molecular Weight | 409.12 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-(5-hydroxy-4-methylpentyl)acetamide |
| SMILES | CC(CO)CCCNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2NO3/c1-10(8-18)3-2-6-17-14(19)9-20-13-5-4-11(15)7-12(13)16/h4-5,7,10,18H,2-3,6,8-9H2,1H3,(H,17,19) |
| InChIKey | VYJURFBXPLWQJN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.12 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|