C16H14Br2ClNO2 — CID 2632590
N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dibromophenoxy)acetamide (PubChem CID 2632590) has the molecular formula C16H14Br2ClNO2 and a molecular weight of 447.55 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dibromophenoxy)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dibromophenoxy)acetamide |
|---|---|
| PubChem CID | 2632590 |
| Molecular Formula | C16H14Br2ClNO2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 444.91 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dibromophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Br2ClNO2/c17-12-3-6-15(14(18)9-12)22-10-16(21)20-8-7-11-1-4-13(19)5-2-11/h1-6,9H,7-8,10H2,(H,20,21) |
| InChIKey | UUCAMDZSRFFPNC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |