C16H24Br2O — CID 139967544
2,4-dibromo-1-(2,6-dimethyloctoxy)benzene (PubChem CID 139967544) has the molecular formula C16H24Br2O and a molecular weight of 392.18 g/mol. Its IUPAC name is 2,4-dibromo-1-(2,6-dimethyloctoxy)benzene.
| Compound Name | 2,4-dibromo-1-(2,6-dimethyloctoxy)benzene |
|---|---|
| PubChem CID | 139967544 |
| Molecular Formula | C16H24Br2O |
| Molecular Weight | 392.18 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2,4-dibromo-1-(2,6-dimethyloctoxy)benzene |
| SMILES | CCC(C)CCCC(C)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H24Br2O/c1-4-12(2)6-5-7-13(3)11-19-16-9-8-14(17)10-15(16)18/h8-10,12-13H,4-7,11H2,1-3H3 |
| InChIKey | UDEQSBWBQAZSFO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.18 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |