C19H22Br2O2 — CID 139605000
4-bromo-2-[(5-bromo-2-methoxyphenyl)methyl]-1-[(2S)-2-methylbutoxy]benzene (PubChem CID 139605000) has the molecular formula C19H22Br2O2 and a molecular weight of 442.19 g/mol. Its IUPAC name is 4-bromo-2-[(5-bromo-2-methoxyphenyl)methyl]-1-[(2S)-2-methylbutoxy]benzene.
| Compound Name | 4-bromo-2-[(5-bromo-2-methoxyphenyl)methyl]-1-[(2S)-2-methylbutoxy]benzene |
|---|---|
| PubChem CID | 139605000 |
| Molecular Formula | C19H22Br2O2 |
| Molecular Weight | 442.19 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 4-bromo-2-[(5-bromo-2-methoxyphenyl)methyl]-1-[(2S)-2-methylbutoxy]benzene |
| SMILES | CC[C@H](C)COc1ccc(Br)cc1Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C19H22Br2O2/c1-4-13(2)12-23-19-8-6-17(21)11-15(19)9-14-10-16(20)5-7-18(14)22-3/h5-8,10-11,13H,4,9,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | NIFKXUIVOPFGEO-ZDUSSCGKSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.19 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |