C12H18BrNO — CID 62505917
2-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine (PubChem CID 62505917) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 62505917 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine |
| SMILES | CCC(CN)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C12H18BrNO/c1-3-9(8-14)6-10-7-11(13)4-5-12(10)15-2/h4-5,7,9H,3,6,8,14H2,1-2H3 |
| InChIKey | RIHPAWOFNKGLKK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |